C14H10O3S — CID 88864833
10-methylsulfanyl-11,12-dioxotricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9-carbaldehyde (PubChem CID 88864833) has the molecular formula C14H10O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 10-methylsulfanyl-11,12-dioxotricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9-carbaldehyde.
| Compound Name | 10-methylsulfanyl-11,12-dioxotricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9-carbaldehyde |
|---|---|
| PubChem CID | 88864833 |
| Molecular Formula | C14H10O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 10-methylsulfanyl-11,12-dioxotricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9-carbaldehyde |
| SMILES | CSC1=C(C=O)C2C(=O)C(=O)C1c1ccccc12 |
| InChI | InChI=1S/C14H10O3S/c1-18-14-9(6-15)10-7-4-2-3-5-8(7)11(14)13(17)12(10)16/h2-6,10-11H,1H3 |
| InChIKey | MKLMXXLWAGZTEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|