About 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene
9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene (PubChem CID 88865063) has the molecular formula C26H13F6OP
and a molecular weight of 486.35 g/mol. Its IUPAC name is 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene.
Molecular Properties
| Compound Name | 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene |
| PubChem CID | 88865063 |
| Molecular Formula | C26H13F6OP |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene |
| SMILES | O=P(c1c(F)cc(F)cc1F)(c1c(F)cc(F)cc1F)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C26H13F6OP/c27-15-10-20(29)25(21(30)11-15)34(33,26-22(31)12-16(28)13-23(26)32)24-9-14-5-1-2-6-17(14)18-7-3-4-8-19(18)24/h1-13H |
| InChIKey | NJZBWPIOHZOKEA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene?
The IUPAC name of 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene (CID 88865063) is 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene.
What is the SMILES notation for 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene?
The canonical SMILES for 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene is O=P(c1c(F)cc(F)cc1F)(c1c(F)cc(F)cc1F)c1cc2ccccc2c2ccccc12.
What is the InChIKey of 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene?
The InChIKey is NJZBWPIOHZOKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H13F6OP/c27-15-10-20(29)25(21(30)11-15)34(33,26-22(31)12-16(28)13-23(26)32)24-9-14-5-1-2-6-17(14)18-7-3-4-8-19(18)24/h1-13H.
What are the key properties of 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene?
9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene has a molecular weight of 486.35 g/mol, XLogP of 6.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bis(2,4,6-trifluorophenyl)phosphorylphenanthrene is sourced from PubChem (CID 88865063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).