C11H16S — CID 88865508
(3Z,5Z)-2-methyl-7-prop-1-en-2-ylsulfanylhepta-1,3,5-triene (PubChem CID 88865508) has the molecular formula C11H16S and a molecular weight of 180.32 g/mol. Its IUPAC name is (3Z,5Z)-2-methyl-7-prop-1-en-2-ylsulfanylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2-methyl-7-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 88865508 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (3Z,5Z)-2-methyl-7-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C/CSC(=C)C |
| InChI | InChI=1S/C11H16S/c1-10(2)8-6-5-7-9-12-11(3)4/h5-8H,1,3,9H2,2,4H3/b7-5-,8-6- |
| InChIKey | SDMFCESWTQNOKW-SFECMWDFSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|