C9H10BrF3 — CID 88865593
(2E,4E)-2-bromo-4-(trifluoromethyl)octa-2,4,6-triene (PubChem CID 88865593) has the molecular formula C9H10BrF3 and a molecular weight of 255.08 g/mol. Its IUPAC name is (2E,4E)-2-bromo-4-(trifluoromethyl)octa-2,4,6-triene.
| Compound Name | (2E,4E)-2-bromo-4-(trifluoromethyl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 88865593 |
| Molecular Formula | C9H10BrF3 |
| Molecular Weight | 255.08 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | (2E,4E)-2-bromo-4-(trifluoromethyl)octa-2,4,6-triene |
| SMILES | CC=C/C=C(\C=C(/C)Br)C(F)(F)F |
| InChI | InChI=1S/C9H10BrF3/c1-3-4-5-8(6-7(2)10)9(11,12)13/h3-6H,1-2H3/b4-3?,7-6+,8-5+ |
| InChIKey | MGYKDYYFECGUJC-SMLVWZADSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.08 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|