C26H33N3O7S2 — CID 88865733
[3-[2-[2-(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]acetyl]oxy-2-hydroxypropyl] 2,2-dimethylbutanoate (PubChem CID 88865733) has the molecular formula C26H33N3O7S2 and a molecular weight of 563.70 g/mol. Its IUPAC name is [3-[2-[2-(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]acetyl]oxy-2-hydroxypropyl] 2,2-dimethylbutanoate.
| Compound Name | [3-[2-[2-(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]acetyl]oxy-2-hydroxypropyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 88865733 |
| Molecular Formula | C26H33N3O7S2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | [3-[2-[2-(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]acetyl]oxy-2-hydroxypropyl] 2,2-dimethylbutanoate |
| SMILES | CCN1C(=O)C(=C2Sc3ccccc3N2CC(=O)OCC(O)COC(=O)C(C)(C)CC)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C26H33N3O7S2/c1-6-26(4,5)24(34)36-15-16(30)14-35-19(31)13-29-17-11-9-10-12-18(17)38-23(29)20-21(32)27(7-2)25(37)28(8-3)22(20)33/h9-12,16,30H,6-8,13-15H2,1-5H3 |
| InChIKey | RFHSHDOJHSMPEQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|