C11H12F12O — CID 88866006
1,1,1,2,3,4,5,5,5-nonafluoro-3-pentoxy-2-(trifluoromethyl)pentane (PubChem CID 88866006) has the molecular formula C11H12F12O and a molecular weight of 388.19 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-3-pentoxy-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-3-pentoxy-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 88866006 |
| Molecular Formula | C11H12F12O |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-3-pentoxy-2-(trifluoromethyl)pentane |
| SMILES | CCCCCOC(F)(C(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F12O/c1-2-3-4-5-24-7(13,6(12)8(14,15)16)9(17,10(18,19)20)11(21,22)23/h6H,2-5H2,1H3 |
| InChIKey | HQMUWHVNOKJFCS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|