C37H26BrN3 — CID 88866076
2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine (PubChem CID 88866076) has the molecular formula C37H26BrN3 and a molecular weight of 592.54 g/mol. Its IUPAC name is 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 88866076 |
| Molecular Formula | C37H26BrN3 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3cc(Br)cc(-c4cc5ccccc5c5ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C37H26BrN3/c1-23-11-15-25(16-12-23)35-39-36(26-17-13-24(2)14-18-26)41-37(40-35)29-19-28(20-30(38)21-29)34-22-27-7-3-4-8-31(27)32-9-5-6-10-33(32)34/h3-22H,1-2H3 |
| InChIKey | QIYYKFQRLYAAEW-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|