C11H13F11O — CID 88866197
2-[difluoro(3,4,4,4-tetrafluorobutan-2-yloxy)methyl]-1,1,1,2,3-pentafluoro-3-methylpentane (PubChem CID 88866197) has the molecular formula C11H13F11O and a molecular weight of 370.20 g/mol. Its IUPAC name is 2-[difluoro(3,4,4,4-tetrafluorobutan-2-yloxy)methyl]-1,1,1,2,3-pentafluoro-3-methylpentane.
| Compound Name | 2-[difluoro(3,4,4,4-tetrafluorobutan-2-yloxy)methyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
|---|---|
| PubChem CID | 88866197 |
| Molecular Formula | C11H13F11O |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[difluoro(3,4,4,4-tetrafluorobutan-2-yloxy)methyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
| SMILES | CCC(C)(F)C(F)(C(F)(F)F)C(F)(F)OC(C)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F11O/c1-4-7(3,13)9(17,10(18,19)20)11(21,22)23-5(2)6(12)8(14,15)16/h5-6H,4H2,1-3H3 |
| InChIKey | IXGPEALQMUAUPR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |