C13H18F10O2 — CID 88866205
1,1,2,2,3,3-hexafluoro-4-methoxy-4-methyl-1-(3,3,4,4-tetrafluoro-2-methylpentan-2-yl)oxypentane (PubChem CID 88866205) has the molecular formula C13H18F10O2 and a molecular weight of 396.27 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-4-methoxy-4-methyl-1-(3,3,4,4-tetrafluoro-2-methylpentan-2-yl)oxypentane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-4-methoxy-4-methyl-1-(3,3,4,4-tetrafluoro-2-methylpentan-2-yl)oxypentane |
|---|---|
| PubChem CID | 88866205 |
| Molecular Formula | C13H18F10O2 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-4-methoxy-4-methyl-1-(3,3,4,4-tetrafluoro-2-methylpentan-2-yl)oxypentane |
| SMILES | COC(C)(C)C(F)(F)C(F)(F)C(F)(F)OC(C)(C)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H18F10O2/c1-7(2,24-6)11(18,19)12(20,21)13(22,23)25-8(3,4)10(16,17)9(5,14)15/h1-6H3 |
| InChIKey | KJGUZZDBRVSRCH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|