C13H20N2 — CID 88866229
5-ethyl-2-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3-dihydropyrazine (PubChem CID 88866229) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-ethyl-2-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3-dihydropyrazine.
| Compound Name | 5-ethyl-2-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3-dihydropyrazine |
|---|---|
| PubChem CID | 88866229 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 5-ethyl-2-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3-dihydropyrazine |
| SMILES | C/C=C\C=C/CC1N=CC(CC)=NC1C |
| InChI | InChI=1S/C13H20N2/c1-4-6-7-8-9-13-11(3)15-12(5-2)10-14-13/h4,6-8,10-11,13H,5,9H2,1-3H3/b6-4-,8-7- |
| InChIKey | NQXSEVSGDOEULK-MOIRPGTBSA-N |
| XLogP | 3.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|