C19H16ClF2N3O2S — CID 88866514
4-(4-chloro-2,6-difluorophenyl)-3-isocyano-2-morpholin-4-yl-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one (PubChem CID 88866514) has the molecular formula C19H16ClF2N3O2S and a molecular weight of 423.87 g/mol. Its IUPAC name is 4-(4-chloro-2,6-difluorophenyl)-3-isocyano-2-morpholin-4-yl-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one.
| Compound Name | 4-(4-chloro-2,6-difluorophenyl)-3-isocyano-2-morpholin-4-yl-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one |
|---|---|
| PubChem CID | 88866514 |
| Molecular Formula | C19H16ClF2N3O2S |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 4-(4-chloro-2,6-difluorophenyl)-3-isocyano-2-morpholin-4-yl-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one |
| SMILES | [C-]#[N+]c1c(N2CCOCC2)sc2c1C(c1c(F)cc(Cl)cc1F)CCNC2=O |
| InChI | InChI=1S/C19H16ClF2N3O2S/c1-23-16-15-11(14-12(21)8-10(20)9-13(14)22)2-3-24-18(26)17(15)28-19(16)25-4-6-27-7-5-25/h8-9,11H,2-7H2,(H,24,26) |
| InChIKey | OFGPAONMJCPGQW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|