About 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole
9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole (PubChem CID 88866546) has the molecular formula C34H25F2N5+2
and a molecular weight of 541.61 g/mol. Its IUPAC name is 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole.
Molecular Properties
| Compound Name | 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole |
| PubChem CID | 88866546 |
| Molecular Formula | C34H25F2N5+2 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole |
| SMILES | C[n+]1cn(-c2cc(-n3c[n+](C)c4ccccc43)c(F)c(-n3c4ccccc4c4ccccc43)c2F)c2ccccc21 |
| InChI | InChI=1S/C34H25F2N5/c1-37-20-39(28-17-9-7-15-26(28)37)30-19-31(40-21-38(2)27-16-8-10-18-29(27)40)33(36)34(32(30)35)41-24-13-5-3-11-22(24)23-12-4-6-14-25(23)41/h3-21H,1-2H3/q+2 |
| InChIKey | LDMMGDSNYSYXNX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 22.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole?
The IUPAC name of 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole (CID 88866546) is 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole.
What is the SMILES notation for 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole?
The canonical SMILES for 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole is C[n+]1cn(-c2cc(-n3c[n+](C)c4ccccc43)c(F)c(-n3c4ccccc4c4ccccc43)c2F)c2ccccc21.
What is the InChIKey of 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole?
The InChIKey is LDMMGDSNYSYXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H25F2N5/c1-37-20-39(28-17-9-7-15-26(28)37)30-19-31(40-21-38(2)27-16-8-10-18-29(27)40)33(36)34(32(30)35)41-24-13-5-3-11-22(24)23-12-4-6-14-25(23)41/h3-21H,1-2H3/q+2.
What are the key properties of 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole?
9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole has a molecular weight of 541.61 g/mol, XLogP of 6.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,6-difluoro-3,5-bis(3-methylbenzimidazol-3-ium-1-yl)phenyl]carbazole is sourced from PubChem (CID 88866546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).