C14H27NO7 — CID 88866584
7-[(2,3,5,6-tetrahydroxy-4-methylhexanoyl)amino]heptanoic acid (PubChem CID 88866584) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is 7-[(2,3,5,6-tetrahydroxy-4-methylhexanoyl)amino]heptanoic acid.
| Compound Name | 7-[(2,3,5,6-tetrahydroxy-4-methylhexanoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 88866584 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 7-[(2,3,5,6-tetrahydroxy-4-methylhexanoyl)amino]heptanoic acid |
| SMILES | CC(C(O)CO)C(O)C(O)C(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C14H27NO7/c1-9(10(17)8-16)12(20)13(21)14(22)15-7-5-3-2-4-6-11(18)19/h9-10,12-13,16-17,20-21H,2-8H2,1H3,(H,15,22)(H,18,19) |
| InChIKey | WCZRIPAYMIPGIM-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|