C22H35N3 — CID 88866590
(2E,4E)-1-cyclohexa-1,3-dien-1-yl-4-ethenyl-3-N-[(Z)-hept-5-en-3-yl]hepta-2,4-diene-1,2,3-triamine (PubChem CID 88866590) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (2E,4E)-1-cyclohexa-1,3-dien-1-yl-4-ethenyl-3-N-[(Z)-hept-5-en-3-yl]hepta-2,4-diene-1,2,3-triamine.
| Compound Name | (2E,4E)-1-cyclohexa-1,3-dien-1-yl-4-ethenyl-3-N-[(Z)-hept-5-en-3-yl]hepta-2,4-diene-1,2,3-triamine |
|---|---|
| PubChem CID | 88866590 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | (2E,4E)-1-cyclohexa-1,3-dien-1-yl-4-ethenyl-3-N-[(Z)-hept-5-en-3-yl]hepta-2,4-diene-1,2,3-triamine |
| SMILES | C=CC(=C\CC)/C(NC(CC)C/C=C\C)=C(\N)C(N)C1=CC=CCC1 |
| InChI | InChI=1S/C22H35N3/c1-5-9-16-19(8-4)25-22(17(7-3)13-6-2)21(24)20(23)18-14-11-10-12-15-18/h5,7,9-11,13-14,19-20,25H,3,6,8,12,15-16,23-24H2,1-2,4H3/b9-5-,17-13+,22-21+ |
| InChIKey | NUIHGHSLMLFSMQ-VWZOUPMESA-N |
| XLogP | 4.62 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|