C36H34F2N2O5S — CID 88866976
2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866976) has the molecular formula C36H34F2N2O5S and a molecular weight of 644.74 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866976 |
| Molecular Formula | C36H34F2N2O5S |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)c2cc(-c3cccc(-c4ccc(F)cc4F)c3)on2)cc1 |
| InChI | InChI=1S/C36H34F2N2O5S/c1-36(2,3)28-13-11-24(12-14-28)31(19-23-7-9-25(10-8-23)35(41)39-17-18-46(42,43)44)33-22-34(45-40-33)27-6-4-5-26(20-27)30-16-15-29(37)21-32(30)38/h4-16,20-22,31H,17-19H2,1-3H3,(H,39,41)(H,42,43,44) |
| InChIKey | DNNLJMCMYBFUJH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|