C37H35F3N2O5S — CID 88866979
2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-[3-(trifluoromethyl)phenyl]phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866979) has the molecular formula C37H35F3N2O5S and a molecular weight of 676.76 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-[3-(trifluoromethyl)phenyl]phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-[3-(trifluoromethyl)phenyl]phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866979 |
| Molecular Formula | C37H35F3N2O5S |
| Molecular Weight | 676.76 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-[3-(trifluoromethyl)phenyl]phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)c2cc(-c3cccc(-c4cccc(C(F)(F)F)c4)c3)on2)cc1 |
| InChI | InChI=1S/C37H35F3N2O5S/c1-36(2,3)30-16-14-25(15-17-30)32(20-24-10-12-26(13-11-24)35(43)41-18-19-48(44,45)46)33-23-34(47-42-33)29-8-4-6-27(21-29)28-7-5-9-31(22-28)37(38,39)40/h4-17,21-23,32H,18-20H2,1-3H3,(H,41,43)(H,44,45,46) |
| InChIKey | CKAUWHXHCXQDRV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.76 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|