C37H35N3O5S — CID 88866996
2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-cyanophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88866996) has the molecular formula C37H35N3O5S and a molecular weight of 633.77 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-cyanophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-cyanophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88866996 |
| Molecular Formula | C37H35N3O5S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-cyanophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)O)cc2)c2cc(-c3cccc(-c4ccc(C#N)cc4)c3)on2)cc1 |
| InChI | InChI=1S/C37H35N3O5S/c1-37(2,3)32-17-15-28(16-18-32)33(21-25-7-13-29(14-8-25)36(41)39-19-20-46(42,43)44)34-23-35(45-40-34)31-6-4-5-30(22-31)27-11-9-26(24-38)10-12-27/h4-18,22-23,33H,19-21H2,1-3H3,(H,39,41)(H,42,43,44) |
| InChIKey | OHRKTMRVYSKTQA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|