About 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane
8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane (PubChem CID 88867101) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 88867101 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane |
| SMILES | [C-]#[N+]C1(CCC)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H19NO2/c1-3-4-11(13-2)5-7-12(8-6-11)14-9-10-15-12/h3-10H2,1H3 |
| InChIKey | HSHVTJJPDMVYBZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane (CID 88867101) is 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane is [C-]#[N+]C1(CCC)CCC2(CC1)OCCO2.
What is the InChIKey of 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is HSHVTJJPDMVYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-3-4-11(13-2)5-7-12(8-6-11)14-9-10-15-12/h3-10H2,1H3.
What are the key properties of 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane?
8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 209.29 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-isocyano-8-propyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 88867101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).