C29H36N4O4 — CID 88867125
1-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-5-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-7-methylquinolin-2-one (PubChem CID 88867125) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-5-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-7-methylquinolin-2-one.
| Compound Name | 1-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-5-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-7-methylquinolin-2-one |
|---|---|
| PubChem CID | 88867125 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]ethyl]-5-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-7-methylquinolin-2-one |
| SMILES | CC/C(=N/O)c1cc(C)cc2c1ccc(=O)n2CCN1CCC(NCc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C29H36N4O4/c1-3-25(31-35)24-16-20(2)17-26-23(24)5-7-29(34)33(26)13-12-32-10-8-22(9-11-32)30-19-21-4-6-27-28(18-21)37-15-14-36-27/h4-7,16-18,22,30,35H,3,8-15,19H2,1-2H3/b31-25- |
| InChIKey | FHGAQIXSOQRQCE-GDWJVWIDSA-N |
| XLogP | 3.92 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|