C15H18O3 — CID 88867131
(1R,7aR)-7a-cyclopropyl-1-ethynyl-1-hydroxy-6-methoxy-2,3,6,7-tetrahydroinden-5-one (PubChem CID 88867131) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1R,7aR)-7a-cyclopropyl-1-ethynyl-1-hydroxy-6-methoxy-2,3,6,7-tetrahydroinden-5-one.
| Compound Name | (1R,7aR)-7a-cyclopropyl-1-ethynyl-1-hydroxy-6-methoxy-2,3,6,7-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 88867131 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1R,7aR)-7a-cyclopropyl-1-ethynyl-1-hydroxy-6-methoxy-2,3,6,7-tetrahydroinden-5-one |
| SMILES | C#C[C@]1(O)CCC2=CC(=O)C(OC)C[C@@]21C1CC1 |
| InChI | InChI=1S/C15H18O3/c1-3-14(17)7-6-11-8-12(16)13(18-2)9-15(11,14)10-4-5-10/h1,8,10,13,17H,4-7,9H2,2H3/t13?,14-,15+/m0/s1 |
| InChIKey | SCJSJZLMDDEHKS-NOYMGPGASA-N |
| XLogP | 1.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|