About N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine
N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine (PubChem CID 88867286) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine |
| PubChem CID | 88867286 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NCCN1CCOCC1 |
| InChI | InChI=1S/C10H18N2O/c1-3-10(2)11-4-5-12-6-8-13-9-7-12/h3,11H,1-2,4-9H2 |
| InChIKey | PINXMXVKXSBFKF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine?
The IUPAC name of N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine (CID 88867286) is N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine.
What is the SMILES notation for N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine?
The canonical SMILES for N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine is C=CC(=C)NCCN1CCOCC1.
What is the InChIKey of N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine?
The InChIKey is PINXMXVKXSBFKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-10(2)11-4-5-12-6-8-13-9-7-12/h3,11H,1-2,4-9H2.
What are the key properties of N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine?
N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine has a molecular weight of 182.27 g/mol, XLogP of 0.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-morpholin-4-ylethyl)buta-1,3-dien-2-amine is sourced from PubChem (CID 88867286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).