About 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine
1-(2-buta-1,3-dien-2-yloxyethyl)piperidine (PubChem CID 88867291) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine.
Molecular Properties
| Compound Name | 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine |
| PubChem CID | 88867291 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine |
| SMILES | C=CC(=C)OCCN1CCCCC1 |
| InChI | InChI=1S/C11H19NO/c1-3-11(2)13-10-9-12-7-5-4-6-8-12/h3H,1-2,4-10H2 |
| InChIKey | JGGLGQZLAWPWMK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine?
The IUPAC name of 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine (CID 88867291) is 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine.
What is the SMILES notation for 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine?
The canonical SMILES for 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine is C=CC(=C)OCCN1CCCCC1.
What is the InChIKey of 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine?
The InChIKey is JGGLGQZLAWPWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-11(2)13-10-9-12-7-5-4-6-8-12/h3H,1-2,4-10H2.
What are the key properties of 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine?
1-(2-buta-1,3-dien-2-yloxyethyl)piperidine has a molecular weight of 181.28 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-buta-1,3-dien-2-yloxyethyl)piperidine is sourced from PubChem (CID 88867291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).