C11H22N2 — CID 88867292
N-buta-1,3-dien-2-yl-N',N'-diethylpropane-1,3-diamine (PubChem CID 88867292) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-buta-1,3-dien-2-yl-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 88867292 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N',N'-diethylpropane-1,3-diamine |
| SMILES | C=CC(=C)NCCCN(CC)CC |
| InChI | InChI=1S/C11H22N2/c1-5-11(4)12-9-8-10-13(6-2)7-3/h5,12H,1,4,6-10H2,2-3H3 |
| InChIKey | CWMMCTQGJNZCRT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|