C11H22O4S — CID 88867307
[1-(methoxymethyl)-2,2,3-trimethylcyclopentyl]methanesulfonic acid (PubChem CID 88867307) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is [1-(methoxymethyl)-2,2,3-trimethylcyclopentyl]methanesulfonic acid.
| Compound Name | [1-(methoxymethyl)-2,2,3-trimethylcyclopentyl]methanesulfonic acid |
|---|---|
| PubChem CID | 88867307 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [1-(methoxymethyl)-2,2,3-trimethylcyclopentyl]methanesulfonic acid |
| SMILES | COCC1(CS(=O)(=O)O)CCC(C)C1(C)C |
| InChI | InChI=1S/C11H22O4S/c1-9-5-6-11(7-15-4,10(9,2)3)8-16(12,13)14/h9H,5-8H2,1-4H3,(H,12,13,14) |
| InChIKey | QLPXPQVRPTXWGC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|