C31H24Cl3F3N2O5S — CID 88867330
2-[[4-[3-[2-chloro-4-(2,4-dichlorophenyl)anilino]-3-oxo-2-[4-(trifluoromethyl)phenyl]propyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 88867330) has the molecular formula C31H24Cl3F3N2O5S and a molecular weight of 699.96 g/mol. Its IUPAC name is 2-[[4-[3-[2-chloro-4-(2,4-dichlorophenyl)anilino]-3-oxo-2-[4-(trifluoromethyl)phenyl]propyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-[2-chloro-4-(2,4-dichlorophenyl)anilino]-3-oxo-2-[4-(trifluoromethyl)phenyl]propyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 88867330 |
| Molecular Formula | C31H24Cl3F3N2O5S |
| Molecular Weight | 699.96 g/mol |
| Exact Mass | 698.04 |
| IUPAC Name | 2-[[4-[3-[2-chloro-4-(2,4-dichlorophenyl)anilino]-3-oxo-2-[4-(trifluoromethyl)phenyl]propyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1ccc(CC(C(=O)Nc2ccc(-c3ccc(Cl)cc3Cl)cc2Cl)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H24Cl3F3N2O5S/c32-23-10-11-24(26(33)17-23)21-7-12-28(27(34)16-21)39-30(41)25(19-5-8-22(9-6-19)31(35,36)37)15-18-1-3-20(4-2-18)29(40)38-13-14-45(42,43)44/h1-12,16-17,25H,13-15H2,(H,38,40)(H,39,41)(H,42,43,44) |
| InChIKey | NWMXNKQSPCBWCD-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.96 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|