About (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine
(Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine (PubChem CID 88867652) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine |
| PubChem CID | 88867652 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine |
| SMILES | C=C(N(/C=C(\N)CC)CC)C(C)(C)CC |
| InChI | InChI=1S/C13H26N2/c1-7-12(14)10-15(9-3)11(4)13(5,6)8-2/h10H,4,7-9,14H2,1-3,5-6H3/b12-10- |
| InChIKey | HCUMTPJMIFXPJI-BENRWUELSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine?
The IUPAC name of (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine (CID 88867652) is (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine is C=C(N(/C=C(\N)CC)CC)C(C)(C)CC.
What is the InChIKey of (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine?
The InChIKey is HCUMTPJMIFXPJI-BENRWUELSA-N. The full InChI is InChI=1S/C13H26N2/c1-7-12(14)10-15(9-3)11(4)13(5,6)8-2/h10H,4,7-9,14H2,1-3,5-6H3/b12-10-.
What are the key properties of (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine?
(Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine has a molecular weight of 210.36 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-(3,3-dimethylpent-1-en-2-yl)-1-N-ethylbut-1-ene-1,2-diamine is sourced from PubChem (CID 88867652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).