About magnesium;1,10-dihydrophenothiazin-1-ide;chloride
magnesium;1,10-dihydrophenothiazin-1-ide;chloride (PubChem CID 88867948) has the molecular formula C12H8ClMgNS
and a molecular weight of 258.03 g/mol. Its IUPAC name is magnesium;1,10-dihydrophenothiazin-1-ide;chloride.
Molecular Properties
| Compound Name | magnesium;1,10-dihydrophenothiazin-1-ide;chloride |
| PubChem CID | 88867948 |
| Molecular Formula | C12H8ClMgNS |
| Molecular Weight | 258.03 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | magnesium;1,10-dihydrophenothiazin-1-ide;chloride |
| SMILES | [Cl-].[Mg+2].[c-]1cccc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C12H8NS.ClH.Mg/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;;/h1-5,7-8,13H;1H;/q-1;;+2/p-1 |
| InChIKey | XYFGAWYWVMYFDA-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,10-dihydrophenothiazin-1-ide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,10-dihydrophenothiazin-1-ide;chloride?
The IUPAC name of magnesium;1,10-dihydrophenothiazin-1-ide;chloride (CID 88867948) is magnesium;1,10-dihydrophenothiazin-1-ide;chloride.
What is the SMILES notation for magnesium;1,10-dihydrophenothiazin-1-ide;chloride?
The canonical SMILES for magnesium;1,10-dihydrophenothiazin-1-ide;chloride is [Cl-].[Mg+2].[c-]1cccc2c1Nc1ccccc1S2.
What is the InChIKey of magnesium;1,10-dihydrophenothiazin-1-ide;chloride?
The InChIKey is XYFGAWYWVMYFDA-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H8NS.ClH.Mg/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;;/h1-5,7-8,13H;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,10-dihydrophenothiazin-1-ide;chloride?
magnesium;1,10-dihydrophenothiazin-1-ide;chloride has a molecular weight of 258.03 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,10-dihydrophenothiazin-1-ide;chloride is sourced from PubChem (CID 88867948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).