C78H68N2 — CID 88869115
9,10-diethyl-2-N,6-N-diphenyl-2-N,6-N-bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)anthracene-2,6-diamine (PubChem CID 88869115) has the molecular formula C78H68N2 and a molecular weight of 1033.42 g/mol. Its IUPAC name is 9,10-diethyl-2-N,6-N-diphenyl-2-N,6-N-bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)anthracene-2,6-diamine.
| Compound Name | 9,10-diethyl-2-N,6-N-diphenyl-2-N,6-N-bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)anthracene-2,6-diamine |
|---|---|
| PubChem CID | 88869115 |
| Molecular Formula | C78H68N2 |
| Molecular Weight | 1033.42 g/mol |
| Exact Mass | 1032.54 |
| IUPAC Name | 9,10-diethyl-2-N,6-N-diphenyl-2-N,6-N-bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)anthracene-2,6-diamine |
| SMILES | CCc1c2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3cc5c(cc3-4)C(C)(C)c3ccccc3-5)cc2c(CC)c2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3cc5c(cc3-4)C(C)(C)c3ccccc3-5)cc12 |
| InChI | InChI=1S/C78H68N2/c1-11-53-55-35-31-50(80(48-25-17-14-18-26-48)52-34-38-60-66-46-72-64(44-74(66)78(9,10)70(60)42-52)58-28-20-22-30-68(58)76(72,5)6)40-62(55)54(12-2)56-36-32-49(39-61(53)56)79(47-23-15-13-16-24-47)51-33-37-59-65-45-71-63(43-73(65)77(7,8)69(59)41-51)57-27-19-21-29-67(57)75(71,3)4/h13-46H,11-12H2,1-10H3 |
| InChIKey | WRTRTBMUOICSME-UHFFFAOYSA-N |
| XLogP | 21.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.42 |
| LogP ≤ 5 | 21.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|