C22H21NO4S — CID 88869319
3-[5-(hydroxymethyl)-1,2-dimethylindol-3-yl]-4-(2,4,5-trimethylthiophen-3-yl)furan-2,5-dione (PubChem CID 88869319) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-1,2-dimethylindol-3-yl]-4-(2,4,5-trimethylthiophen-3-yl)furan-2,5-dione.
| Compound Name | 3-[5-(hydroxymethyl)-1,2-dimethylindol-3-yl]-4-(2,4,5-trimethylthiophen-3-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 88869319 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-[5-(hydroxymethyl)-1,2-dimethylindol-3-yl]-4-(2,4,5-trimethylthiophen-3-yl)furan-2,5-dione |
| SMILES | Cc1sc(C)c(C2=C(c3c(C)n(C)c4ccc(CO)cc34)C(=O)OC2=O)c1C |
| InChI | InChI=1S/C22H21NO4S/c1-10-12(3)28-13(4)17(10)19-20(22(26)27-21(19)25)18-11(2)23(5)16-7-6-14(9-24)8-15(16)18/h6-8,24H,9H2,1-5H3 |
| InChIKey | LFFKYAYMYATIGC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|