C6F10O6S2 — CID 88869456
3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide (PubChem CID 88869456) has the molecular formula C6F10O6S2 and a molecular weight of 422.17 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide.
| Compound Name | 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 88869456 |
| Molecular Formula | C6F10O6S2 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(C(F)(F)C(F)(F)C2(F)C(F)(F)OS2(=O)=O)C1(F)F |
| InChI | InChI=1S/C6F10O6S2/c7-1(8,3(11)6(15,16)24(19,20)21-3)2(9,10)4(12)5(13,14)22-23(4,17)18 |
| InChIKey | NVCPILXGYDZSSZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|