C21H24N2 — CID 88870015
5-benzyl-2-(4-buta-2,3-dien-2-ylpiperidin-1-yl)pyridine (PubChem CID 88870015) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-benzyl-2-(4-buta-2,3-dien-2-ylpiperidin-1-yl)pyridine.
| Compound Name | 5-benzyl-2-(4-buta-2,3-dien-2-ylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 88870015 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 5-benzyl-2-(4-buta-2,3-dien-2-ylpiperidin-1-yl)pyridine |
| SMILES | C=C=C(C)C1CCN(c2ccc(Cc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C21H24N2/c1-3-17(2)20-11-13-23(14-12-20)21-10-9-19(16-22-21)15-18-7-5-4-6-8-18/h4-10,16,20H,1,11-15H2,2H3 |
| InChIKey | JYEVEDWPJBRMJF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |