About (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol
(5-chloro-1,2,4-thiadiazol-3-yl)methanethiol (PubChem CID 88870033) has the molecular formula C3H3ClN2S2
and a molecular weight of 166.66 g/mol. Its IUPAC name is (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol.
Molecular Properties
| Compound Name | (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol |
| PubChem CID | 88870033 |
| Molecular Formula | C3H3ClN2S2 |
| Molecular Weight | 166.66 g/mol |
| Exact Mass | 165.94 |
| IUPAC Name | (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol |
| SMILES | SCc1nsc(Cl)n1 |
| InChI | InChI=1S/C3H3ClN2S2/c4-3-5-2(1-7)6-8-3/h7H,1H2 |
| InChIKey | JEDMYTIERSXPIE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol?
The IUPAC name of (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol (CID 88870033) is (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol.
What is the SMILES notation for (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol?
The canonical SMILES for (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol is SCc1nsc(Cl)n1.
What is the InChIKey of (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol?
The InChIKey is JEDMYTIERSXPIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClN2S2/c4-3-5-2(1-7)6-8-3/h7H,1H2.
What are the key properties of (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol?
(5-chloro-1,2,4-thiadiazol-3-yl)methanethiol has a molecular weight of 166.66 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,2,4-thiadiazol-3-yl)methanethiol is sourced from PubChem (CID 88870033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).