C22H18N2 — CID 88870056
2-(5-methyl-14-propan-2-yl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene)propanedinitrile (PubChem CID 88870056) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(5-methyl-14-propan-2-yl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene)propanedinitrile.
| Compound Name | 2-(5-methyl-14-propan-2-yl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene)propanedinitrile |
|---|---|
| PubChem CID | 88870056 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(5-methyl-14-propan-2-yl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene)propanedinitrile |
| SMILES | Cc1ccc2c(c1)C(=C(C#N)C#N)c1cc(C(C)C)ccc1C=C2 |
| InChI | InChI=1S/C22H18N2/c1-14(2)18-9-8-17-7-6-16-5-4-15(3)10-20(16)22(21(17)11-18)19(12-23)13-24/h4-11,14H,1-3H3 |
| InChIKey | GMIWGNIAYDMSSE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|