About 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole
2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole (PubChem CID 88870246) has the molecular formula C10H8F6N2
and a molecular weight of 270.18 g/mol. Its IUPAC name is 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole |
| PubChem CID | 88870246 |
| Molecular Formula | C10H8F6N2 |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole |
| SMILES | Cc1nc2c([nH]1)CC(C(F)(F)F)C=C2C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2/c1-4-17-7-3-5(9(11,12)13)2-6(8(7)18-4)10(14,15)16/h2,5H,3H2,1H3,(H,17,18) |
| InChIKey | XNGLNWUBOSPDSX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole?
The IUPAC name of 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole (CID 88870246) is 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole.
What is the SMILES notation for 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole?
The canonical SMILES for 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole is Cc1nc2c([nH]1)CC(C(F)(F)F)C=C2C(F)(F)F.
What is the InChIKey of 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole?
The InChIKey is XNGLNWUBOSPDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F6N2/c1-4-17-7-3-5(9(11,12)13)2-6(8(7)18-4)10(14,15)16/h2,5H,3H2,1H3,(H,17,18).
What are the key properties of 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole?
2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole has a molecular weight of 270.18 g/mol, XLogP of 3.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-bis(trifluoromethyl)-6,7-dihydro-1H-benzimidazole is sourced from PubChem (CID 88870246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).