C25H28F3N5O3S — CID 88870278
N'-hydroxy-2-methoxy-4-[[4-[(4-methylpiperazin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 88870278) has the molecular formula C25H28F3N5O3S and a molecular weight of 535.59 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-4-[[4-[(4-methylpiperazin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methoxy-4-[[4-[(4-methylpiperazin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 88870278 |
| Molecular Formula | C25H28F3N5O3S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N'-hydroxy-2-methoxy-4-[[4-[(4-methylpiperazin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | COc1cc(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CN2CCN(C)CC2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C25H28F3N5O3S/c1-32-9-11-33(12-10-32)14-20-22(15-36-18-7-8-19(23(29)31-34)21(13-18)35-2)37-24(30-20)16-3-5-17(6-4-16)25(26,27)28/h3-8,13,34H,9-12,14-15H2,1-2H3,(H2,29,31) |
| InChIKey | CGBMCVHLXCISSO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|