C25H27F3N4O4S — CID 88870293
N'-hydroxy-4-[[4-[(4-hydroxypiperidin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methoxybenzenecarboximidamide (PubChem CID 88870293) has the molecular formula C25H27F3N4O4S and a molecular weight of 536.58 g/mol. Its IUPAC name is N'-hydroxy-4-[[4-[(4-hydroxypiperidin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methoxybenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[[4-[(4-hydroxypiperidin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 88870293 |
| Molecular Formula | C25H27F3N4O4S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N'-hydroxy-4-[[4-[(4-hydroxypiperidin-1-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methoxybenzenecarboximidamide |
| SMILES | COc1cc(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CN2CCC(O)CC2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C25H27F3N4O4S/c1-35-21-12-18(6-7-19(21)23(29)31-34)36-14-22-20(13-32-10-8-17(33)9-11-32)30-24(37-22)15-2-4-16(5-3-15)25(26,27)28/h2-7,12,17,33-34H,8-11,13-14H2,1H3,(H2,29,31) |
| InChIKey | WJXNVSRUXKTWBZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|