C26H25Cl2FN2O2 — CID 88870538
(3R,4S,5S)-4-(2-amino-4-chlorophenyl)-5-(3-chlorophenyl)-3-(5-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-7-oxoazepane-4-carbaldehyde (PubChem CID 88870538) has the molecular formula C26H25Cl2FN2O2 and a molecular weight of 487.40 g/mol. Its IUPAC name is (3R,4S,5S)-4-(2-amino-4-chlorophenyl)-5-(3-chlorophenyl)-3-(5-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-7-oxoazepane-4-carbaldehyde.
| Compound Name | (3R,4S,5S)-4-(2-amino-4-chlorophenyl)-5-(3-chlorophenyl)-3-(5-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-7-oxoazepane-4-carbaldehyde |
|---|---|
| PubChem CID | 88870538 |
| Molecular Formula | C26H25Cl2FN2O2 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (3R,4S,5S)-4-(2-amino-4-chlorophenyl)-5-(3-chlorophenyl)-3-(5-fluoro-2-methylcyclohexa-2,4-dien-1-yl)-7-oxoazepane-4-carbaldehyde |
| SMILES | CC1=CC=C(F)CC1[C@H]1CNC(=O)C[C@@H](c2cccc(Cl)c2)[C@@]1(C=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C26H25Cl2FN2O2/c1-15-5-7-19(29)11-20(15)23-13-31-25(33)12-22(16-3-2-4-17(27)9-16)26(23,14-32)21-8-6-18(28)10-24(21)30/h2-10,14,20,22-23H,11-13,30H2,1H3,(H,31,33)/t20?,22-,23+,26+/m0/s1 |
| InChIKey | QKKXVAVSABSLRP-HAXIUNQNSA-N |
| XLogP | 5.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|