About N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine
N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine (PubChem CID 88870595) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine.
Molecular Properties
| Compound Name | N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine |
| PubChem CID | 88870595 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine |
| SMILES | CCC/C=N/CC(C)C(/C=C\C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H33N/c1-8-9-12-18-13-15(4)16(14(2)3)10-11-17(5,6)7/h10-12,14-16H,8-9,13H2,1-7H3/b11-10-,18-12+ |
| InChIKey | KGSHKWYSQGRSBA-RDWZXGDNSA-N |
| XLogP | 5.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine?
The IUPAC name of N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine (CID 88870595) is N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine.
What is the SMILES notation for N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine?
The canonical SMILES for N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine is CCC/C=N/CC(C)C(/C=C\C(C)(C)C)C(C)C.
What is the InChIKey of N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine?
The InChIKey is KGSHKWYSQGRSBA-RDWZXGDNSA-N. The full InChI is InChI=1S/C17H33N/c1-8-9-12-18-13-15(4)16(14(2)3)10-11-17(5,6)7/h10-12,14-16H,8-9,13H2,1-7H3/b11-10-,18-12+.
What are the key properties of N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine?
N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine has a molecular weight of 251.46 g/mol, XLogP of 5.37, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2,6,6-trimethyl-3-propan-2-ylhept-4-enyl]butan-1-imine is sourced from PubChem (CID 88870595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).