C21H23N3O5 — CID 88870640
1'-(2-amino-2-oxoethyl)-N-hydroxy-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine oxide (PubChem CID 88870640) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 1'-(2-amino-2-oxoethyl)-N-hydroxy-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine oxide.
| Compound Name | 1'-(2-amino-2-oxoethyl)-N-hydroxy-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine oxide |
|---|---|
| PubChem CID | 88870640 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1'-(2-amino-2-oxoethyl)-N-hydroxy-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine oxide |
| SMILES | COc1cc([NH+]([O-])O)cc2c1OC1(C=C2)N(CC(N)=O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H23N3O5/c1-20(2)15-6-4-5-7-16(15)23(12-18(22)25)21(20)9-8-13-10-14(24(26)27)11-17(28-3)19(13)29-21/h4-11,24,26H,12H2,1-3H3,(H2,22,25) |
| InChIKey | NQJBJBMDAUANOR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|