About CID 88870663
CID 88870663 (PubChem CID 88870663) has the molecular formula C14H19BN2
and a molecular weight of 226.13 g/mol.
Molecular Properties
| Compound Name | CID 88870663 |
| PubChem CID | 88870663 |
| Molecular Formula | C14H19BN2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | — |
| SMILES | [H]/N=C/C([B])(C)CC1C=CC=C(/N=C/C=C\C)C1 |
| InChI | InChI=1S/C14H19BN2/c1-3-4-8-17-13-7-5-6-12(9-13)10-14(2,15)11-16/h3-8,11-12,16H,9-10H2,1-2H3/b4-3-,16-11+,17-8+ |
| InChIKey | FATYQBGKJXZVEM-DNKHSTLHSA-N |
| XLogP | 3.48 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 88870663 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88870663?
The IUPAC name of CID 88870663 (CID 88870663) is not available.
What is the SMILES notation for CID 88870663?
The canonical SMILES for CID 88870663 is [H]/N=C/C([B])(C)CC1C=CC=C(/N=C/C=C\C)C1.
What is the InChIKey of CID 88870663?
The InChIKey is FATYQBGKJXZVEM-DNKHSTLHSA-N. The full InChI is InChI=1S/C14H19BN2/c1-3-4-8-17-13-7-5-6-12(9-13)10-14(2,15)11-16/h3-8,11-12,16H,9-10H2,1-2H3/b4-3-,16-11+,17-8+.
What are the key properties of CID 88870663?
CID 88870663 has a molecular weight of 226.13 g/mol, XLogP of 3.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88870663 is sourced from PubChem (CID 88870663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).