About (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene
(3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene (PubChem CID 88870770) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene.
Molecular Properties
| Compound Name | (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene |
| PubChem CID | 88870770 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene |
| SMILES | C=C/C(=C\[C@H](C)CC)COC |
| InChI | InChI=1S/C10H18O/c1-5-9(3)7-10(6-2)8-11-4/h6-7,9H,2,5,8H2,1,3-4H3/b10-7+/t9-/m1/s1 |
| InChIKey | MWIIHEPXBGFMQY-YIXGCBLDSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene?
The IUPAC name of (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene (CID 88870770) is (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene.
What is the SMILES notation for (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene?
The canonical SMILES for (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene is C=C/C(=C\[C@H](C)CC)COC.
What is the InChIKey of (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene?
The InChIKey is MWIIHEPXBGFMQY-YIXGCBLDSA-N. The full InChI is InChI=1S/C10H18O/c1-5-9(3)7-10(6-2)8-11-4/h6-7,9H,2,5,8H2,1,3-4H3/b10-7+/t9-/m1/s1.
What are the key properties of (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene?
(3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene has a molecular weight of 154.25 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5R)-3-(methoxymethyl)-5-methylhepta-1,3-diene is sourced from PubChem (CID 88870770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).