C14H28O2 — CID 88870818
2,3,3-trimethyl-4-(2-methylpent-4-en-2-yl)pentane-1,5-diol (PubChem CID 88870818) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-(2-methylpent-4-en-2-yl)pentane-1,5-diol.
| Compound Name | 2,3,3-trimethyl-4-(2-methylpent-4-en-2-yl)pentane-1,5-diol |
|---|---|
| PubChem CID | 88870818 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2,3,3-trimethyl-4-(2-methylpent-4-en-2-yl)pentane-1,5-diol |
| SMILES | C=CCC(C)(C)C(CO)C(C)(C)C(C)CO |
| InChI | InChI=1S/C14H28O2/c1-7-8-13(3,4)12(10-16)14(5,6)11(2)9-15/h7,11-12,15-16H,1,8-10H2,2-6H3 |
| InChIKey | MQRFSOHCKCHZAS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|