C16H19F3N4O5 — CID 88870820
3-[(3-amino-6-methoxy-2-pyridinyl)-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]amino]-3-oxopropanoic acid (PubChem CID 88870820) has the molecular formula C16H19F3N4O5 and a molecular weight of 404.35 g/mol. Its IUPAC name is 3-[(3-amino-6-methoxy-2-pyridinyl)-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[(3-amino-6-methoxy-2-pyridinyl)-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 88870820 |
| Molecular Formula | C16H19F3N4O5 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-[(3-amino-6-methoxy-2-pyridinyl)-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]amino]-3-oxopropanoic acid |
| SMILES | COc1ccc(N)c(N(C(=O)CC(=O)O)C2CCN(C(=O)C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C16H19F3N4O5/c1-28-11-3-2-10(20)14(21-11)23(12(24)8-13(25)26)9-4-6-22(7-5-9)15(27)16(17,18)19/h2-3,9H,4-8,20H2,1H3,(H,25,26) |
| InChIKey | QUKPHQDHRSGFMG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|