C15H17N — CID 88870875
(2Z,4E,6Z)-N,4-dimethyl-6-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hexa-2,4-dien-1-imine (PubChem CID 88870875) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (2Z,4E,6Z)-N,4-dimethyl-6-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E,6Z)-N,4-dimethyl-6-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 88870875 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2Z,4E,6Z)-N,4-dimethyl-6-(6-methylidenecyclohexa-2,4-dien-1-ylidene)hexa-2,4-dien-1-imine |
| SMILES | C=c1cccc/c1=C/C=C(C)/C=C\C=N\C |
| InChI | InChI=1S/C15H17N/c1-13(7-6-12-16-3)10-11-15-9-5-4-8-14(15)2/h4-12H,2H2,1,3H3/b7-6-,13-10+,15-11-,16-12+ |
| InChIKey | VYXAKZBHDUWTQX-QEFUHUNCSA-N |
| XLogP | 2.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|