C16H24N4O8 — CID 88871217
ethyl (2R,3R)-3-[[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]-(2-oxoethyl)carbamoyl]oxirane-2-carboxylate (PubChem CID 88871217) has the molecular formula C16H24N4O8 and a molecular weight of 400.39 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]-(2-oxoethyl)carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]-(2-oxoethyl)carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 88871217 |
| Molecular Formula | C16H24N4O8 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl (2R,3R)-3-[[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]amino]-(2-oxoethyl)carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H]1C(=O)N(CC=O)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C16H24N4O8/c1-5-27-16(26)12-11(28-12)15(25)20(6-7-21)19-14(24)9(3)18-13(23)8(2)17-10(4)22/h7-9,11-12H,5-6H2,1-4H3,(H,17,22)(H,18,23)(H,19,24)/t8-,9-,11+,12+/m0/s1 |
| InChIKey | QNFGVPONSWPJLY-GAIPPQHRSA-N |
| XLogP | -2.60 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|