About (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole
(2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole (PubChem CID 88871482) has the molecular formula C23H25N2+
and a molecular weight of 329.47 g/mol. Its IUPAC name is (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole.
Molecular Properties
| Compound Name | (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole |
| PubChem CID | 88871482 |
| Molecular Formula | C23H25N2+ |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole |
| SMILES | Cc1ccc2c(c1)C/C(=C/C=CC1=[N+](C)c3ccc(C)cc3C1)N2C |
| InChI | InChI=1S/C23H25N2/c1-16-8-10-22-18(12-16)14-20(24(22)3)6-5-7-21-15-19-13-17(2)9-11-23(19)25(21)4/h5-13H,14-15H2,1-4H3/q+1 |
| InChIKey | CURAZYYHWXXQLB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole?
The IUPAC name of (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole (CID 88871482) is (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole.
What is the SMILES notation for (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole?
The canonical SMILES for (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole is Cc1ccc2c(c1)C/C(=C/C=CC1=[N+](C)c3ccc(C)cc3C1)N2C.
What is the InChIKey of (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole?
The InChIKey is CURAZYYHWXXQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N2/c1-16-8-10-22-18(12-16)14-20(24(22)3)6-5-7-21-15-19-13-17(2)9-11-23(19)25(21)4/h5-13H,14-15H2,1-4H3/q+1.
What are the key properties of (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole?
(2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole has a molecular weight of 329.47 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[3-(1,5-dimethyl-3H-indol-1-ium-2-yl)prop-2-enylidene]-1,5-dimethyl-3H-indole is sourced from PubChem (CID 88871482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).