About N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide
N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide (PubChem CID 888717) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide |
| PubChem CID | 888717 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide |
| SMILES | CCCN1C(=O)c2ccc(C(=O)Nc3ccc(O)cc3)cc2C1=O |
| InChI | InChI=1S/C18H16N2O4/c1-2-9-20-17(23)14-8-3-11(10-15(14)18(20)24)16(22)19-12-4-6-13(21)7-5-12/h3-8,10,21H,2,9H2,1H3,(H,19,22) |
| InChIKey | YMODJNWWGPXFAY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide?
The IUPAC name of N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide (CID 888717) is N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide.
What is the SMILES notation for N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide?
The canonical SMILES for N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide is CCCN1C(=O)c2ccc(C(=O)Nc3ccc(O)cc3)cc2C1=O.
What is the InChIKey of N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide?
The InChIKey is YMODJNWWGPXFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-2-9-20-17(23)14-8-3-11(10-15(14)18(20)24)16(22)19-12-4-6-13(21)7-5-12/h3-8,10,21H,2,9H2,1H3,(H,19,22).
What are the key properties of N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide?
N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide has a molecular weight of 324.34 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxyphenyl)-1,3-dioxo-2-propylisoindole-5-carboxamide is sourced from PubChem (CID 888717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).