About (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one
(3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one (PubChem CID 88872174) has the molecular formula C17H32O2Si
and a molecular weight of 296.53 g/mol. Its IUPAC name is (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one |
| PubChem CID | 88872174 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C(C)=C/CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-15(12-13-16(2)18)11-9-8-10-14-19-20(6,7)17(3,4)5/h11-13H,8-10,14H2,1-7H3/b13-12+,15-11+ |
| InChIKey | VBCWJUSRBZWXGD-GLZRVVIGSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one?
The IUPAC name of (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one (CID 88872174) is (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one.
What is the SMILES notation for (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one?
The canonical SMILES for (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one is CC(=O)/C=C/C(C)=C/CCCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one?
The InChIKey is VBCWJUSRBZWXGD-GLZRVVIGSA-N. The full InChI is InChI=1S/C17H32O2Si/c1-15(12-13-16(2)18)11-9-8-10-14-19-20(6,7)17(3,4)5/h11-13H,8-10,14H2,1-7H3/b13-12+,15-11+.
What are the key properties of (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one?
(3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one has a molecular weight of 296.53 g/mol, XLogP of 5.27, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-10-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-3,5-dien-2-one is sourced from PubChem (CID 88872174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).