C19H30O2 — CID 88872176
methyl (2E,6E,8E,10E)-10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoate (PubChem CID 88872176) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is methyl (2E,6E,8E,10E)-10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoate.
| Compound Name | methyl (2E,6E,8E,10E)-10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoate |
|---|---|
| PubChem CID | 88872176 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | methyl (2E,6E,8E,10E)-10-tert-butyl-2,8-dimethyldodeca-2,6,8,10-tetraenoate |
| SMILES | C/C=C(\C=C(C)\C=C\CC/C=C(\C)C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C19H30O2/c1-8-17(19(4,5)6)14-15(2)12-10-9-11-13-16(3)18(20)21-7/h8,10,12-14H,9,11H2,1-7H3/b12-10+,15-14+,16-13+,17-8+ |
| InChIKey | XLCWZNAYEYCNLJ-TUFAIYLKSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|