C23H33F3O6 — CID 88872570
2,2,2-trifluoroethyl 6-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-5-formyloxy-3-methylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 88872570) has the molecular formula C23H33F3O6 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 6-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-5-formyloxy-3-methylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 6-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-5-formyloxy-3-methylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88872570 |
| Molecular Formula | C23H33F3O6 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2,2,2-trifluoroethyl 6-(2-tert-butyl-2,4-dimethylpent-3-enoyl)oxy-5-formyloxy-3-methylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)=CC(C)(C(=O)OC1C2CC(C(C)C2C(=O)OCC(F)(F)F)C1OC=O)C(C)(C)C |
| InChI | InChI=1S/C23H33F3O6/c1-12(2)9-22(7,21(4,5)6)20(29)32-18-15-8-14(17(18)31-11-27)13(3)16(15)19(28)30-10-23(24,25)26/h9,11,13-18H,8,10H2,1-7H3 |
| InChIKey | GMROVCZRUTZZKX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|